About 4-sulfanylidene-1,3-oxazolidin-2-one
4-sulfanylidene-1,3-oxazolidin-2-one (PubChem CID 15292581) has the molecular formula C3H3NO2S
and a molecular weight of 117.13 g/mol. Its IUPAC name is 4-sulfanylidene-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-sulfanylidene-1,3-oxazolidin-2-one |
| PubChem CID | 15292581 |
| Molecular Formula | C3H3NO2S |
| Molecular Weight | 117.13 g/mol |
| Exact Mass | 116.99 |
| IUPAC Name | 4-sulfanylidene-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(=S)CO1 |
| InChI | InChI=1S/C3H3NO2S/c5-3-4-2(7)1-6-3/h1H2,(H,4,5,7) |
| InChIKey | IFXJQJKDPAJVMO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.13 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanylidene-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanylidene-1,3-oxazolidin-2-one?
The IUPAC name of 4-sulfanylidene-1,3-oxazolidin-2-one (CID 15292581) is 4-sulfanylidene-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-sulfanylidene-1,3-oxazolidin-2-one?
The canonical SMILES for 4-sulfanylidene-1,3-oxazolidin-2-one is O=C1NC(=S)CO1.
What is the InChIKey of 4-sulfanylidene-1,3-oxazolidin-2-one?
The InChIKey is IFXJQJKDPAJVMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3NO2S/c5-3-4-2(7)1-6-3/h1H2,(H,4,5,7).
What are the key properties of 4-sulfanylidene-1,3-oxazolidin-2-one?
4-sulfanylidene-1,3-oxazolidin-2-one has a molecular weight of 117.13 g/mol, XLogP of 0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanylidene-1,3-oxazolidin-2-one is sourced from PubChem (CID 15292581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).