C21H30O3 — CID 15292916
(8S,9S,10R,13S,14S)-13-ethylspiro[1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-11-one (PubChem CID 15292916) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-13-ethylspiro[1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-11-one.
| Compound Name | (8S,9S,10R,13S,14S)-13-ethylspiro[1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-11-one |
|---|---|
| PubChem CID | 15292916 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (8S,9S,10R,13S,14S)-13-ethylspiro[1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-11-one |
| SMILES | CC[C@]12CC(=O)[C@H]3[C@@H](CCC4=CCCC[C@@H]43)[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C21H30O3/c1-2-20-13-18(22)19-15-6-4-3-5-14(15)7-8-16(19)17(20)9-10-21(20)23-11-12-24-21/h5,15-17,19H,2-4,6-13H2,1H3/t15-,16-,17-,19+,20-/m0/s1 |
| InChIKey | JWVLRQIKOHQINI-CAVMOMJPSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|