C28H23N5O — CID 152929266
(5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-pyridin-3-yl-2-quinolin-4-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 152929266) has the molecular formula C28H23N5O and a molecular weight of 445.53 g/mol. Its IUPAC name is (5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-pyridin-3-yl-2-quinolin-4-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-pyridin-3-yl-2-quinolin-4-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 152929266 |
| Molecular Formula | C28H23N5O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (5aR,6R,9aS)-6,9a-dimethyl-7-oxo-3-pyridin-3-yl-2-quinolin-4-yl-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4ccnc5ccccc45)n(-c4cccnc4)c3CC[C@H]12 |
| InChI | InChI=1S/C28H23N5O/c1-17-22-9-10-24-26(28(22,2)14-18(15-29)25(17)34)32-27(33(24)19-6-5-12-30-16-19)21-11-13-31-23-8-4-3-7-20(21)23/h3-8,11-14,16-17,22H,9-10H2,1-2H3/t17-,22-,28-/m1/s1 |
| InChIKey | UKQDOIIVHWDKQQ-DHBJDBKLSA-N |
| XLogP | 4.97 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |