About 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline
6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline (PubChem CID 152929403) has the molecular formula C16H21N3S
and a molecular weight of 287.43 g/mol. Its IUPAC name is 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline.
Molecular Properties
| Compound Name | 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline |
| PubChem CID | 152929403 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline |
| SMILES | CC[C@@H]1CNCCCN1Sc1ccc2cnccc2c1 |
| InChI | InChI=1S/C16H21N3S/c1-2-15-12-17-7-3-9-19(15)20-16-5-4-14-11-18-8-6-13(14)10-16/h4-6,8,10-11,15,17H,2-3,7,9,12H2,1H3/t15-/m1/s1 |
| InChIKey | UKQXCSOKZRPLLD-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline?
The IUPAC name of 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline (CID 152929403) is 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline.
What is the SMILES notation for 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline?
The canonical SMILES for 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline is CC[C@@H]1CNCCCN1Sc1ccc2cnccc2c1.
What is the InChIKey of 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline?
The InChIKey is UKQXCSOKZRPLLD-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H21N3S/c1-2-15-12-17-7-3-9-19(15)20-16-5-4-14-11-18-8-6-13(14)10-16/h4-6,8,10-11,15,17H,2-3,7,9,12H2,1H3/t15-/m1/s1.
What are the key properties of 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline?
6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline has a molecular weight of 287.43 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(2R)-2-ethyl-1,4-diazepan-1-yl]sulfanyl]isoquinoline is sourced from PubChem (CID 152929403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).