C21H27NO5S — CID 15292956
2,3-dimethoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)thiolan-2-yl]aniline (PubChem CID 15292956) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)thiolan-2-yl]aniline.
| Compound Name | 2,3-dimethoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)thiolan-2-yl]aniline |
|---|---|
| PubChem CID | 15292956 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2,3-dimethoxy-5-[(2S,5S)-5-(3,4,5-trimethoxyphenyl)thiolan-2-yl]aniline |
| SMILES | COc1cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)S2)cc(N)c1OC |
| InChI | InChI=1S/C21H27NO5S/c1-23-15-9-12(8-14(22)20(15)26-4)18-6-7-19(28-18)13-10-16(24-2)21(27-5)17(11-13)25-3/h8-11,18-19H,6-7,22H2,1-5H3/t18-,19-/m0/s1 |
| InChIKey | POSPQAJGZMVRQZ-OALUTQOASA-N |
| XLogP | 4.62 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|