C16H15ClN4OS — CID 152933290
2-[[(2S)-azetidin-2-yl]-sulfanylmethyl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 152933290) has the molecular formula C16H15ClN4OS and a molecular weight of 346.84 g/mol. Its IUPAC name is 2-[[(2S)-azetidin-2-yl]-sulfanylmethyl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[[(2S)-azetidin-2-yl]-sulfanylmethyl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 152933290 |
| Molecular Formula | C16H15ClN4OS |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-[[(2S)-azetidin-2-yl]-sulfanylmethyl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | O=c1c2c(Cl)ccn2nc(C(S)[C@@H]2CCN2)n1-c1ccccc1 |
| InChI | InChI=1S/C16H15ClN4OS/c17-11-7-9-20-13(11)16(22)21(10-4-2-1-3-5-10)15(19-20)14(23)12-6-8-18-12/h1-5,7,9,12,14,18,23H,6,8H2/t12-,14?/m0/s1 |
| InChIKey | ULJSINCUHNAXRA-NBFOIZRFSA-N |
| XLogP | 2.47 |
| TPSA | 51.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|