C24H22I2N4O3 — CID 152933687
tert-butyl 7-(4-hydroxy-3,5-diiodophenyl)-3,8,10,11-tetrahydroindazolo[4,5-f][2,7]naphthyridine-9-carboxylate (PubChem CID 152933687) has the molecular formula C24H22I2N4O3 and a molecular weight of 668.27 g/mol. Its IUPAC name is tert-butyl 7-(4-hydroxy-3,5-diiodophenyl)-3,8,10,11-tetrahydroindazolo[4,5-f][2,7]naphthyridine-9-carboxylate.
| Compound Name | tert-butyl 7-(4-hydroxy-3,5-diiodophenyl)-3,8,10,11-tetrahydroindazolo[4,5-f][2,7]naphthyridine-9-carboxylate |
|---|---|
| PubChem CID | 152933687 |
| Molecular Formula | C24H22I2N4O3 |
| Molecular Weight | 668.27 g/mol |
| Exact Mass | 667.98 |
| IUPAC Name | tert-butyl 7-(4-hydroxy-3,5-diiodophenyl)-3,8,10,11-tetrahydroindazolo[4,5-f][2,7]naphthyridine-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(c(-c3cc(I)c(O)c(I)c3)nc3ccc4[nH]ncc4c23)C1 |
| InChI | InChI=1S/C24H22I2N4O3/c1-24(2,3)33-23(32)30-7-6-13-15(11-30)21(12-8-16(25)22(31)17(26)9-12)28-19-5-4-18-14(20(13)19)10-27-29-18/h4-5,8-10,31H,6-7,11H2,1-3H3,(H,27,29) |
| InChIKey | ULLNCNPIPMBADN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.27 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|