C15H24N2O5 — CID 15293457
methyl (6R,8aR)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylate (PubChem CID 15293457) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is methyl (6R,8aR)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylate.
| Compound Name | methyl (6R,8aR)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylate |
|---|---|
| PubChem CID | 15293457 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | methyl (6R,8aR)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylate |
| SMILES | COC(=O)[C@]12CCCN1C(=O)[C@H](NC(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C15H24N2O5/c1-14(2,3)22-13(20)16-10-6-8-15(12(19)21-4)7-5-9-17(15)11(10)18/h10H,5-9H2,1-4H3,(H,16,20)/t10-,15-/m1/s1 |
| InChIKey | AGWLFSYFDFJTHT-MEBBXXQBSA-N |
| XLogP | 1.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |