C18H28N2O2 — CID 152937491
[(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]-[[2-methyl-1-(2-methylphenoxy)propan-2-yl]amino]methanol (PubChem CID 152937491) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is [(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]-[[2-methyl-1-(2-methylphenoxy)propan-2-yl]amino]methanol.
| Compound Name | [(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]-[[2-methyl-1-(2-methylphenoxy)propan-2-yl]amino]methanol |
|---|---|
| PubChem CID | 152937491 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | [(1R,5S)-3-methyl-3-azabicyclo[3.1.0]hexan-6-yl]-[[2-methyl-1-(2-methylphenoxy)propan-2-yl]amino]methanol |
| SMILES | Cc1ccccc1OCC(C)(C)NC(O)C1[C@H]2CN(C)C[C@@H]12 |
| InChI | InChI=1S/C18H28N2O2/c1-12-7-5-6-8-15(12)22-11-18(2,3)19-17(21)16-13-9-20(4)10-14(13)16/h5-8,13-14,16-17,19,21H,9-11H2,1-4H3/t13-,14+,16?,17? |
| InChIKey | UMDPIRYSPFJXOV-CBHXASLJSA-N |
| XLogP | 1.87 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|