C18H21Cl2N6O8PS — CID 152939092
[(2R,3S,4R,5R)-5-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoylmethylphosphonic acid (PubChem CID 152939092) has the molecular formula C18H21Cl2N6O8PS and a molecular weight of 583.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoylmethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoylmethylphosphonic acid |
|---|---|
| PubChem CID | 152939092 |
| Molecular Formula | C18H21Cl2N6O8PS |
| Molecular Weight | 583.35 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-chloro-4-[(2-chlorophenyl)methylamino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfamoylmethylphosphonic acid |
| SMILES | O=P(O)(O)CS(=O)(=O)NC[C@H]1O[C@@H](n2ncc3c(NCc4ccccc4Cl)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21Cl2N6O8PS/c19-11-4-2-1-3-9(11)5-21-15-10-6-22-26(16(10)25-18(20)24-15)17-14(28)13(27)12(34-17)7-23-36(32,33)8-35(29,30)31/h1-4,6,12-14,17,23,27-28H,5,7-8H2,(H,21,24,25)(H2,29,30,31)/t12-,13-,14-,17-/m1/s1 |
| InChIKey | UMLMGVPVDXWACC-VMUDFCTBSA-N |
| XLogP | 0.42 |
| TPSA | 209.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|