C30H26N4O5 — CID 152941133
4-[(3aS,5R,7aR)-5-hydroxy-4-methyl-7-[2-(1-methylindazol-3-yl)oxyethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 152941133) has the molecular formula C30H26N4O5 and a molecular weight of 522.56 g/mol. Its IUPAC name is 4-[(3aS,5R,7aR)-5-hydroxy-4-methyl-7-[2-(1-methylindazol-3-yl)oxyethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aS,5R,7aR)-5-hydroxy-4-methyl-7-[2-(1-methylindazol-3-yl)oxyethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 152941133 |
| Molecular Formula | C30H26N4O5 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 4-[(3aS,5R,7aR)-5-hydroxy-4-methyl-7-[2-(1-methylindazol-3-yl)oxyethyl]-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | Cn1nc(OCCC23C[C@@H](O)C(C)(O2)[C@H]2C(=O)N(c4ccc(C#N)c5ccccc45)C(=O)[C@H]23)c2ccccc21 |
| InChI | InChI=1S/C30H26N4O5/c1-29-23(35)15-30(39-29,13-14-38-26-20-9-5-6-10-21(20)33(2)32-26)25-24(29)27(36)34(28(25)37)22-12-11-17(16-31)18-7-3-4-8-19(18)22/h3-12,23-25,35H,13-15H2,1-2H3/t23-,24-,25+,29?,30?/m1/s1 |
| InChIKey | UMVCTAQKYLFADB-CGHKXIPFSA-N |
| XLogP | 3.47 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|