C11H20N2 — CID 15294214
7-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine (PubChem CID 15294214) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 7-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine.
| Compound Name | 7-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
|---|---|
| PubChem CID | 15294214 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 7-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1H-isoindol-4-amine |
| SMILES | CC(C)C1C=CC(N)C2CNCC12 |
| InChI | InChI=1S/C11H20N2/c1-7(2)8-3-4-11(12)10-6-13-5-9(8)10/h3-4,7-11,13H,5-6,12H2,1-2H3 |
| InChIKey | GPHDVZHPWUOPBG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|