About phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium
phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium (PubChem CID 152942860) has the molecular formula C36H25I6O6S+
and a molecular weight of 1347.08 g/mol. Its IUPAC name is phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium.
Molecular Properties
| Compound Name | phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium |
| PubChem CID | 152942860 |
| Molecular Formula | C36H25I6O6S+ |
| Molecular Weight | 1347.08 g/mol |
| Exact Mass | 1346.56 |
| IUPAC Name | phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium |
| SMILES | O=C(OCCOc1ccc([S+](c2ccccc2)c2ccc(OCCOC(=O)c3c(I)ccc(I)c3I)cc2)cc1)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C36H25I6O6S/c37-27-14-16-29(39)33(41)31(27)35(43)47-20-18-45-22-6-10-25(11-7-22)49(24-4-2-1-3-5-24)26-12-8-23(9-13-26)46-19-21-48-36(44)32-28(38)15-17-30(40)34(32)42/h1-17H,18-21H2/q+1 |
| InChIKey | UNEAHHYXSDUPQV-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1347.08 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium?
The IUPAC name of phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium (CID 152942860) is phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium.
What is the SMILES notation for phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium?
The canonical SMILES for phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium is O=C(OCCOc1ccc([S+](c2ccccc2)c2ccc(OCCOC(=O)c3c(I)ccc(I)c3I)cc2)cc1)c1c(I)ccc(I)c1I.
What is the InChIKey of phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium?
The InChIKey is UNEAHHYXSDUPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H25I6O6S/c37-27-14-16-29(39)33(41)31(27)35(43)47-20-18-45-22-6-10-25(11-7-22)49(24-4-2-1-3-5-24)26-12-8-23(9-13-26)46-19-21-48-36(44)32-28(38)15-17-30(40)34(32)42/h1-17H,18-21H2/q+1.
What are the key properties of phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium?
phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium has a molecular weight of 1347.08 g/mol, XLogP of 10.88, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]sulfanium is sourced from PubChem (CID 152942860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).