C35H51IO14 — CID 152948601
(2S)-2-[5-benzoyloxy-3-hydroxy-2-(hydroxymethyl)-6-[5-iodo-3-methyl-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxycyclohexyl]oxyoxan-4-yl]oxy-3-cyclohexylpropanoic acid (PubChem CID 152948601) has the molecular formula C35H51IO14 and a molecular weight of 822.68 g/mol. Its IUPAC name is (2S)-2-[5-benzoyloxy-3-hydroxy-2-(hydroxymethyl)-6-[5-iodo-3-methyl-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxycyclohexyl]oxyoxan-4-yl]oxy-3-cyclohexylpropanoic acid.
| Compound Name | (2S)-2-[5-benzoyloxy-3-hydroxy-2-(hydroxymethyl)-6-[5-iodo-3-methyl-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxycyclohexyl]oxyoxan-4-yl]oxy-3-cyclohexylpropanoic acid |
|---|---|
| PubChem CID | 152948601 |
| Molecular Formula | C35H51IO14 |
| Molecular Weight | 822.68 g/mol |
| Exact Mass | 822.23 |
| IUPAC Name | (2S)-2-[5-benzoyloxy-3-hydroxy-2-(hydroxymethyl)-6-[5-iodo-3-methyl-2-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxycyclohexyl]oxyoxan-4-yl]oxy-3-cyclohexylpropanoic acid |
| SMILES | CC1CC(I)CC(OC2OC(CO)C(O)C(O[C@@H](CC3CCCCC3)C(=O)O)C2OC(=O)c2ccccc2)C1OC1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C35H51IO14/c1-17-13-21(36)15-22(29(17)50-34-28(41)27(40)25(38)18(2)45-34)47-35-31(49-33(44)20-11-7-4-8-12-20)30(26(39)24(16-37)48-35)46-23(32(42)43)14-19-9-5-3-6-10-19/h4,7-8,11-12,17-19,21-31,34-35,37-41H,3,5-6,9-10,13-16H2,1-2H3,(H,42,43)/t17?,18?,21?,22?,23-,24?,25?,26?,27?,28?,29?,30?,31?,34?,35?/m0/s1 |
| InChIKey | UOGAWHKSEBCGSK-DYEQHZMJSA-N |
| XLogP | 1.93 |
| TPSA | 210.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.68 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|