C36H44N6O6S — CID 152949714
(8S,11R)-11-(benzylsulfonylmethyl)-N-[(4-carbamimidoylphenyl)methyl]-2,10,17-trioxo-3,9,16-triazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-8-carboxamide (PubChem CID 152949714) has the molecular formula C36H44N6O6S and a molecular weight of 688.85 g/mol. Its IUPAC name is (8S,11R)-11-(benzylsulfonylmethyl)-N-[(4-carbamimidoylphenyl)methyl]-2,10,17-trioxo-3,9,16-triazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-8-carboxamide.
| Compound Name | (8S,11R)-11-(benzylsulfonylmethyl)-N-[(4-carbamimidoylphenyl)methyl]-2,10,17-trioxo-3,9,16-triazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-8-carboxamide |
|---|---|
| PubChem CID | 152949714 |
| Molecular Formula | C36H44N6O6S |
| Molecular Weight | 688.85 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | (8S,11R)-11-(benzylsulfonylmethyl)-N-[(4-carbamimidoylphenyl)methyl]-2,10,17-trioxo-3,9,16-triazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-8-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCCCNC(=O)c3cccc(c3)C(=O)NCCCC[C@@H](CS(=O)(=O)Cc3ccccc3)C(=O)N2)cc1 |
| InChI | InChI=1S/C36H44N6O6S/c37-32(38)27-17-15-25(16-18-27)22-41-36(46)31-14-5-7-20-40-34(44)29-13-8-12-28(21-29)33(43)39-19-6-4-11-30(35(45)42-31)24-49(47,48)23-26-9-2-1-3-10-26/h1-3,8-10,12-13,15-18,21,30-31H,4-7,11,14,19-20,22-24H2,(H3,37,38)(H,39,43)(H,40,44)(H,41,46)(H,42,45)/t30-,31-/m0/s1 |
| InChIKey | UOLLUJPHEVDEMB-CONSDPRKSA-N |
| XLogP | 2.82 |
| TPSA | 200.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.85 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|