C27H20F4N2O2 — CID 152952496
(3S)-4-(5-fluoro-6-phenylindol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one (PubChem CID 152952496) has the molecular formula C27H20F4N2O2 and a molecular weight of 480.46 g/mol. Its IUPAC name is (3S)-4-(5-fluoro-6-phenylindol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one.
| Compound Name | (3S)-4-(5-fluoro-6-phenylindol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 152952496 |
| Molecular Formula | C27H20F4N2O2 |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (3S)-4-(5-fluoro-6-phenylindol-1-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2ccc3cc(F)c(-c4ccccc4)cc32)cc1C(F)(F)F |
| InChI | InChI=1S/C27H20F4N2O2/c1-26(35,25(34)13-17-8-9-23(32-2)21(12-17)27(29,30)31)16-33-11-10-19-14-22(28)20(15-24(19)33)18-6-4-3-5-7-18/h3-12,14-15,35H,13,16H2,1H3/t26-/m0/s1 |
| InChIKey | UOZAOUWVCDFSCO-SANMLTNESA-N |
| XLogP | 6.58 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|