C7H15NO — CID 152953520
(2S)-1-methoxy-N,3-dimethylbut-3-en-2-amine (PubChem CID 152953520) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (2S)-1-methoxy-N,3-dimethylbut-3-en-2-amine.
| Compound Name | (2S)-1-methoxy-N,3-dimethylbut-3-en-2-amine |
|---|---|
| PubChem CID | 152953520 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (2S)-1-methoxy-N,3-dimethylbut-3-en-2-amine |
| SMILES | C=C(C)[C@@H](COC)NC |
| InChI | InChI=1S/C7H15NO/c1-6(2)7(8-3)5-9-4/h7-8H,1,5H2,2-4H3/t7-/m1/s1 |
| InChIKey | UPECBPMKHQMPRN-SSDOTTSWSA-N |
| XLogP | 0.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|