C9H8IN5 — CID 152956826
N-iodo-N-methyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine (PubChem CID 152956826) has the molecular formula C9H8IN5 and a molecular weight of 313.10 g/mol. Its IUPAC name is N-iodo-N-methyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine.
| Compound Name | N-iodo-N-methyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine |
|---|---|
| PubChem CID | 152956826 |
| Molecular Formula | C9H8IN5 |
| Molecular Weight | 313.10 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | N-iodo-N-methyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-amine |
| SMILES | CN(I)c1cnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C9H8IN5/c1-14(10)8-5-12-7-4-13-9-6(15(7)8)2-3-11-9/h2-5,11H,1H3 |
| InChIKey | UPUGBVOPHAFOQM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|