C21H35BN6O6 — CID 15295712
[4-(diaminomethylideneamino)-1-[[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetyl]amino]butyl]boronic acid (PubChem CID 15295712) has the molecular formula C21H35BN6O6 and a molecular weight of 478.36 g/mol. Its IUPAC name is [4-(diaminomethylideneamino)-1-[[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetyl]amino]butyl]boronic acid.
| Compound Name | [4-(diaminomethylideneamino)-1-[[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 15295712 |
| Molecular Formula | C21H35BN6O6 |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [4-(diaminomethylideneamino)-1-[[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]acetyl]amino]butyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)C(=O)NCC(=O)NC(CCCN=C(N)N)B(O)O |
| InChI | InChI=1S/C21H35BN6O6/c1-21(2,3)34-20(31)27-15(12-14-8-5-4-6-9-14)18(30)26-13-17(29)28-16(22(32)33)10-7-11-25-19(23)24/h4-6,8-9,15-16,32-33H,7,10-13H2,1-3H3,(H,26,30)(H,27,31)(H,28,29)(H4,23,24,25)/t15-,16?/m1/s1 |
| InChIKey | LVJFWIWJZGNUGU-AAFJCEBUSA-N |
| XLogP | -1.21 |
| TPSA | 201.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|