About N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid
N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid (PubChem CID 15295736) has the molecular formula C23H31NO3S
and a molecular weight of 401.57 g/mol. Its IUPAC name is N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid.
Molecular Properties
| Compound Name | N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid |
| PubChem CID | 15295736 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid |
| SMILES | CC(C)(C)NC1C=CC(c2ccccc2)(c2ccccc2)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C22H27N.CH4O3S/c1-21(2,3)23-20-14-16-22(17-15-20,18-10-6-4-7-11-18)19-12-8-5-9-13-19;1-5(2,3)4/h4-14,16,20,23H,15,17H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | DEZYXWVEASLAAI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid?
The IUPAC name of N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid (CID 15295736) is N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid.
What is the SMILES notation for N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid?
The canonical SMILES for N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid is CC(C)(C)NC1C=CC(c2ccccc2)(c2ccccc2)CC1.CS(=O)(=O)O.
What is the InChIKey of N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid?
The InChIKey is DEZYXWVEASLAAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N.CH4O3S/c1-21(2,3)23-20-14-16-22(17-15-20,18-10-6-4-7-11-18)19-12-8-5-9-13-19;1-5(2,3)4/h4-14,16,20,23H,15,17H2,1-3H3;1H3,(H,2,3,4).
What are the key properties of N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid?
N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid has a molecular weight of 401.57 g/mol, XLogP of 4.58, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4,4-diphenylcyclohex-2-en-1-amine;methanesulfonic acid is sourced from PubChem (CID 15295736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).