About 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide
2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide (PubChem CID 15296045) has the molecular formula C12H11N3O4
and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide |
| PubChem CID | 15296045 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide |
| SMILES | NC(=O)CC1N=C(c2ccc(NC=O)cc2)OC1=O |
| InChI | InChI=1S/C12H11N3O4/c13-10(17)5-9-12(18)19-11(15-9)7-1-3-8(4-2-7)14-6-16/h1-4,6,9H,5H2,(H2,13,17)(H,14,16) |
| InChIKey | DACNOQLIIFHDRN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide?
The IUPAC name of 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide (CID 15296045) is 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide.
What is the SMILES notation for 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide?
The canonical SMILES for 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide is NC(=O)CC1N=C(c2ccc(NC=O)cc2)OC1=O.
What is the InChIKey of 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide?
The InChIKey is DACNOQLIIFHDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O4/c13-10(17)5-9-12(18)19-11(15-9)7-1-3-8(4-2-7)14-6-16/h1-4,6,9H,5H2,(H2,13,17)(H,14,16).
What are the key properties of 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide?
2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide has a molecular weight of 261.24 g/mol, XLogP of -0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-formamidophenyl)-5-oxo-4H-1,3-oxazol-4-yl]acetamide is sourced from PubChem (CID 15296045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).