C16H21NO3 — CID 15296047
tert-butyl N-[(2S)-3-oxo-1-phenylpent-4-en-2-yl]carbamate (PubChem CID 15296047) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-oxo-1-phenylpent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-oxo-1-phenylpent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 15296047 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | tert-butyl N-[(2S)-3-oxo-1-phenylpent-4-en-2-yl]carbamate |
| SMILES | C=CC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21NO3/c1-5-14(18)13(11-12-9-7-6-8-10-12)17-15(19)20-16(2,3)4/h5-10,13H,1,11H2,2-4H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | YAABAAPIHZWIND-ZDUSSCGKSA-N |
| XLogP | 2.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|