C23H18N4O2 — CID 152961018
1-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl]indole-3-carbaldehyde (PubChem CID 152961018) has the molecular formula C23H18N4O2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl]indole-3-carbaldehyde.
| Compound Name | 1-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 152961018 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-[[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]methyl]indole-3-carbaldehyde |
| SMILES | Cc1cc(Cn2cc(C=O)c3ccccc32)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C23H18N4O2/c1-15-10-16(12-26-13-17(14-28)18-6-2-5-9-21(18)26)23(29)22(11-15)27-24-19-7-3-4-8-20(19)25-27/h2-11,13-14,29H,12H2,1H3 |
| InChIKey | UQOKUGIYNKSTOK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|