C17H31NO5Si — CID 152964085
2-trimethylsilylethyl (E)-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]prop-2-enoate (PubChem CID 152964085) has the molecular formula C17H31NO5Si and a molecular weight of 357.52 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E)-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]prop-2-enoate.
| Compound Name | 2-trimethylsilylethyl (E)-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 152964085 |
| Molecular Formula | C17H31NO5Si |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 2-trimethylsilylethyl (E)-3-[(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)amino]prop-2-enoate |
| SMILES | CC1(C)OCC(C)(C)C(C(=O)N/C=C/C(=O)OCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C17H31NO5Si/c1-16(2)12-22-17(3,4)23-14(16)15(20)18-9-8-13(19)21-10-11-24(5,6)7/h8-9,14H,10-12H2,1-7H3,(H,18,20)/b9-8+ |
| InChIKey | URDYXAJSZYFXKZ-CMDGGOBGSA-N |
| XLogP | 2.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|