About 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine
2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine (PubChem CID 152964452) has the molecular formula C16H18Cl2N2O2S
and a molecular weight of 373.31 g/mol. Its IUPAC name is 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine.
Molecular Properties
| Compound Name | 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine |
| PubChem CID | 152964452 |
| Molecular Formula | C16H18Cl2N2O2S |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine |
| SMILES | CC(C)(C)CS(=O)(=O)c1ccc(Cc2nc(Cl)ncc2Cl)cc1 |
| InChI | InChI=1S/C16H18Cl2N2O2S/c1-16(2,3)10-23(21,22)12-6-4-11(5-7-12)8-14-13(17)9-19-15(18)20-14/h4-7,9H,8,10H2,1-3H3 |
| InChIKey | URFUBYOOXLHUAS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine?
The IUPAC name of 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine (CID 152964452) is 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine.
What is the SMILES notation for 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine?
The canonical SMILES for 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine is CC(C)(C)CS(=O)(=O)c1ccc(Cc2nc(Cl)ncc2Cl)cc1.
What is the InChIKey of 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine?
The InChIKey is URFUBYOOXLHUAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2O2S/c1-16(2,3)10-23(21,22)12-6-4-11(5-7-12)8-14-13(17)9-19-15(18)20-14/h4-7,9H,8,10H2,1-3H3.
What are the key properties of 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine?
2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine has a molecular weight of 373.31 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-4-[[4-(2,2-dimethylpropylsulfonyl)phenyl]methyl]pyrimidine is sourced from PubChem (CID 152964452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).