C59H54N4OSi2 — CID 152965126
5-N,9-N-bis(5-methyl-2-pyridinyl)-5-N,9-N-bis(4-trimethylsilylphenyl)spiro[benzo[c]fluorene-7,9'-xanthene]-5,9-diamine (PubChem CID 152965126) has the molecular formula C59H54N4OSi2 and a molecular weight of 891.28 g/mol. Its IUPAC name is 5-N,9-N-bis(5-methyl-2-pyridinyl)-5-N,9-N-bis(4-trimethylsilylphenyl)spiro[benzo[c]fluorene-7,9'-xanthene]-5,9-diamine.
| Compound Name | 5-N,9-N-bis(5-methyl-2-pyridinyl)-5-N,9-N-bis(4-trimethylsilylphenyl)spiro[benzo[c]fluorene-7,9'-xanthene]-5,9-diamine |
|---|---|
| PubChem CID | 152965126 |
| Molecular Formula | C59H54N4OSi2 |
| Molecular Weight | 891.28 g/mol |
| Exact Mass | 890.38 |
| IUPAC Name | 5-N,9-N-bis(5-methyl-2-pyridinyl)-5-N,9-N-bis(4-trimethylsilylphenyl)spiro[benzo[c]fluorene-7,9'-xanthene]-5,9-diamine |
| SMILES | Cc1ccc(N(c2ccc([Si](C)(C)C)cc2)c2ccc3c(c2)C2(c4ccccc4Oc4ccccc42)c2cc(N(c4ccc([Si](C)(C)C)cc4)c4ccc(C)cn4)c4ccccc4c2-3)nc1 |
| InChI | InChI=1S/C59H54N4OSi2/c1-39-21-33-56(60-37-39)62(41-23-28-44(29-24-41)65(3,4)5)43-27-32-48-51(35-43)59(49-17-11-13-19-54(49)64-55-20-14-12-18-50(55)59)52-36-53(46-15-9-10-16-47(46)58(48)52)63(57-34-22-40(2)38-61-57)42-25-30-45(31-26-42)66(6,7)8/h9-38H,1-8H3 |
| InChIKey | URIZREGSJRDWHX-UHFFFAOYSA-N |
| XLogP | 14.75 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.28 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|