C27H32F4N4O — CID 152965620
2,2-difluoro-3-[8-fluoro-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol (PubChem CID 152965620) has the molecular formula C27H32F4N4O and a molecular weight of 504.57 g/mol. Its IUPAC name is 2,2-difluoro-3-[8-fluoro-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[8-fluoro-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 152965620 |
| Molecular Formula | C27H32F4N4O |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 2,2-difluoro-3-[8-fluoro-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-ol |
| SMILES | CC1Cc2c([nH]c3c(F)cccc23)C(c2ccc(NC3CN(CCCF)C3)cc2)N1CC(F)(F)CO |
| InChI | InChI=1S/C27H32F4N4O/c1-17-12-22-21-4-2-5-23(29)24(21)33-25(22)26(35(17)15-27(30,31)16-36)18-6-8-19(9-7-18)32-20-13-34(14-20)11-3-10-28/h2,4-9,17,20,26,32-33,36H,3,10-16H2,1H3 |
| InChIKey | URLJVGNHAOTYOF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|