C23H45BN2O3 — CID 152966120
(1R,2R,5R)-N-tert-butyl-2-[(dimethylamino)methyl]-1-methyl-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexane-1-carboxamide (PubChem CID 152966120) has the molecular formula C23H45BN2O3 and a molecular weight of 408.44 g/mol. Its IUPAC name is (1R,2R,5R)-N-tert-butyl-2-[(dimethylamino)methyl]-1-methyl-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | (1R,2R,5R)-N-tert-butyl-2-[(dimethylamino)methyl]-1-methyl-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 152966120 |
| Molecular Formula | C23H45BN2O3 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.35 |
| IUPAC Name | (1R,2R,5R)-N-tert-butyl-2-[(dimethylamino)methyl]-1-methyl-5-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]cyclohexane-1-carboxamide |
| SMILES | CN(C)C[C@@H]1CC[C@@H](CCB2OC(C)(C)C(C)(C)O2)C[C@@]1(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H45BN2O3/c1-20(2,3)25-19(27)23(8)15-17(11-12-18(23)16-26(9)10)13-14-24-28-21(4,5)22(6,7)29-24/h17-18H,11-16H2,1-10H3,(H,25,27)/t17-,18-,23+/m0/s1 |
| InChIKey | URNVVUQGDOJDJN-IUKKYPGJSA-N |
| XLogP | 4.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|