C14H22N2 — CID 15296936
N,N-dimethyl-4-(piperidin-4-ylmethyl)aniline (PubChem CID 15296936) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N,N-dimethyl-4-(piperidin-4-ylmethyl)aniline.
| Compound Name | N,N-dimethyl-4-(piperidin-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 15296936 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N,N-dimethyl-4-(piperidin-4-ylmethyl)aniline |
| SMILES | CN(C)c1ccc(CC2CCNCC2)cc1 |
| InChI | InChI=1S/C14H22N2/c1-16(2)14-5-3-12(4-6-14)11-13-7-9-15-10-8-13/h3-6,13,15H,7-11H2,1-2H3 |
| InChIKey | JWTWLGSLAXBJDD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|