C17H36O2Si — CID 152970053
(4R,5R)-2-butyl-2-tert-butyl-4,5-di(propan-2-yl)-1,3,2-dioxasilinane (PubChem CID 152970053) has the molecular formula C17H36O2Si and a molecular weight of 300.56 g/mol. Its IUPAC name is (4R,5R)-2-butyl-2-tert-butyl-4,5-di(propan-2-yl)-1,3,2-dioxasilinane.
| Compound Name | (4R,5R)-2-butyl-2-tert-butyl-4,5-di(propan-2-yl)-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 152970053 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (4R,5R)-2-butyl-2-tert-butyl-4,5-di(propan-2-yl)-1,3,2-dioxasilinane |
| SMILES | CCCC[Si]1(C(C)(C)C)OC[C@@H](C(C)C)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C17H36O2Si/c1-9-10-11-20(17(6,7)8)18-12-15(13(2)3)16(19-20)14(4)5/h13-16H,9-12H2,1-8H3/t15-,16+,20?/m0/s1 |
| InChIKey | USHJXZPFJBKEDK-QRFGBVCESA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|