C19H24I3N3O9 — CID 152972840
5-[acetyl(2,3-dihydroxypropyl)amino]-1-N-(2,3-dihydroxypropyl)-3-N-(2,3-dihydroxypropylidene)-2,4,6-triiodobenzene-1,3-dicarboxamide (PubChem CID 152972840) has the molecular formula C19H24I3N3O9 and a molecular weight of 819.12 g/mol. Its IUPAC name is 5-[acetyl(2,3-dihydroxypropyl)amino]-1-N-(2,3-dihydroxypropyl)-3-N-(2,3-dihydroxypropylidene)-2,4,6-triiodobenzene-1,3-dicarboxamide.
| Compound Name | 5-[acetyl(2,3-dihydroxypropyl)amino]-1-N-(2,3-dihydroxypropyl)-3-N-(2,3-dihydroxypropylidene)-2,4,6-triiodobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 152972840 |
| Molecular Formula | C19H24I3N3O9 |
| Molecular Weight | 819.12 g/mol |
| Exact Mass | 818.86 |
| IUPAC Name | 5-[acetyl(2,3-dihydroxypropyl)amino]-1-N-(2,3-dihydroxypropyl)-3-N-(2,3-dihydroxypropylidene)-2,4,6-triiodobenzene-1,3-dicarboxamide |
| SMILES | CC(=O)N(CC(O)CO)c1c(I)c(C(=O)/N=C/C(O)CO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C19H24I3N3O9/c1-8(29)25(4-11(32)7-28)17-15(21)12(18(33)23-2-9(30)5-26)14(20)13(16(17)22)19(34)24-3-10(31)6-27/h2,9-11,26-28,30-32H,3-7H2,1H3,(H,24,34)/b23-2+ |
| InChIKey | USUYYXBZSDGCQK-ZTHPEUCGSA-N |
| XLogP | -1.15 |
| TPSA | 200.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.12 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|