C31H27BNO2S — CID 152975097
CID 152975097 (PubChem CID 152975097) has the molecular formula C31H27BNO2S and a molecular weight of 488.44 g/mol.
| Compound Name | CID 152975097 |
|---|---|
| PubChem CID | 152975097 |
| Molecular Formula | C31H27BNO2S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1ccc(-c2nc3ccccc3c3c2ccc2c4ccccc4sc23)cc1 |
| InChI | InChI=1S/C31H27BNO2S/c1-30(2,34)31(3,4)35-32-20-15-13-19(14-16-20)28-24-18-17-22-21-9-6-8-12-26(21)36-29(22)27(24)23-10-5-7-11-25(23)33-28/h5-18,34H,1-4H3 |
| InChIKey | FIZQAKHMCYIWEF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|