C19H23NO4 — CID 15297708
(2E,4E,6E)-7-cyclohexyl-N-[(1S,5R,6S)-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]hepta-2,4,6-trienamide (PubChem CID 15297708) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2E,4E,6E)-7-cyclohexyl-N-[(1S,5R,6S)-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]hepta-2,4,6-trienamide.
| Compound Name | (2E,4E,6E)-7-cyclohexyl-N-[(1S,5R,6S)-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 15297708 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2E,4E,6E)-7-cyclohexyl-N-[(1S,5R,6S)-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]hepta-2,4,6-trienamide |
| SMILES | O=C(/C=C/C=C/C=C/C1CCCCC1)NC1=C[C@@H](O)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C19H23NO4/c21-15-12-14(17(23)19-18(15)24-19)20-16(22)11-7-2-1-4-8-13-9-5-3-6-10-13/h1-2,4,7-8,11-13,15,18-19,21H,3,5-6,9-10H2,(H,20,22)/b2-1+,8-4+,11-7+/t15-,18+,19-/m1/s1 |
| InChIKey | WUKHGHNKUYDSGO-NBISCXLTSA-N |
| XLogP | 1.95 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|