About (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one
(4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one (PubChem CID 15297915) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one.
Molecular Properties
| Compound Name | (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one |
| PubChem CID | 15297915 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one |
| SMILES | CO[C@H]1CCC[C@@H]([C@@H]2CC(=O)N2)C1=O |
| InChI | InChI=1S/C10H15NO3/c1-14-8-4-2-3-6(10(8)13)7-5-9(12)11-7/h6-8H,2-5H2,1H3,(H,11,12)/t6-,7-,8-/m0/s1 |
| InChIKey | RCNAETFNLVLZQJ-FXQIFTODSA-N |
| XLogP | 0.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one?
The IUPAC name of (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one (CID 15297915) is (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one.
What is the SMILES notation for (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one?
The canonical SMILES for (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one is CO[C@H]1CCC[C@@H]([C@@H]2CC(=O)N2)C1=O.
What is the InChIKey of (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one?
The InChIKey is RCNAETFNLVLZQJ-FXQIFTODSA-N. The full InChI is InChI=1S/C10H15NO3/c1-14-8-4-2-3-6(10(8)13)7-5-9(12)11-7/h6-8H,2-5H2,1H3,(H,11,12)/t6-,7-,8-/m0/s1.
What are the key properties of (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one?
(4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one has a molecular weight of 197.23 g/mol, XLogP of 0.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(1S,3S)-3-methoxy-2-oxocyclohexyl]azetidin-2-one is sourced from PubChem (CID 15297915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).