C15H32O2Si — CID 152979243
tert-butyl-dimethyl-[(2R,3R,5S)-2,3,5,6-tetramethyloxan-4-yl]oxysilane (PubChem CID 152979243) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,3R,5S)-2,3,5,6-tetramethyloxan-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,3R,5S)-2,3,5,6-tetramethyloxan-4-yl]oxysilane |
|---|---|
| PubChem CID | 152979243 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,3R,5S)-2,3,5,6-tetramethyloxan-4-yl]oxysilane |
| SMILES | CC1O[C@H](C)[C@@H](C)C(O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C15H32O2Si/c1-10-12(3)16-13(4)11(2)14(10)17-18(8,9)15(5,6)7/h10-14H,1-9H3/t10-,11+,12-,13?,14?/m1/s1 |
| InChIKey | UUAQJLWSSGAUTR-LYGKVCMISA-N |
| XLogP | 4.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|