About (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+)
(6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) (PubChem CID 152982407) has the molecular formula C8H7NU
and a molecular weight of 355.18 g/mol. Its IUPAC name is (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+).
Molecular Properties
| Compound Name | (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) |
| PubChem CID | 152982407 |
| Molecular Formula | C8H7NU |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) |
| SMILES | C/[C-]=C1\C=CC=CC1=[N-].[U+2] |
| InChI | InChI=1S/C8H7N.U/c1-2-7-5-3-4-6-8(7)9;/h3-6H,1H3;/q-2;+2 |
| InChIKey | MLSLXTMRLAOYTK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+)?
The IUPAC name of (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) (CID 152982407) is (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+).
What is the SMILES notation for (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+)?
The canonical SMILES for (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) is C/[C-]=C1\C=CC=CC1=[N-].[U+2].
What is the InChIKey of (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+)?
The InChIKey is MLSLXTMRLAOYTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.U/c1-2-7-5-3-4-6-8(7)9;/h3-6H,1H3;/q-2;+2.
What are the key properties of (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+)?
(6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) has a molecular weight of 355.18 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethylidenecyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) is sourced from PubChem (CID 152982407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).