C9H8O4 — CID 152983654
(1S,2R,6S,7R)-4,9-dioxatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione (PubChem CID 152983654) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4,9-dioxatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4,9-dioxatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
|---|---|
| PubChem CID | 152983654 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | (1S,2R,6S,7R)-4,9-dioxatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1[C@H]1C[C@@H]2C2OC21 |
| InChI | InChI=1S/C9H8O4/c10-8-4-2-1-3(7-6(2)12-7)5(4)9(11)13-8/h2-7H,1H2/t2-,3+,4+,5-,6?,7? |
| InChIKey | UUWMOJSMSOVYSY-UIHVAESESA-N |
| XLogP | -0.28 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|