C10H19N7S — CID 152984781
2-[2-[(2-methylimino-1,3-thiazolidin-4-yl)methylamino]-4,5-dihydro-1H-imidazol-5-yl]ethanimidamide (PubChem CID 152984781) has the molecular formula C10H19N7S and a molecular weight of 269.38 g/mol. Its IUPAC name is 2-[2-[(2-methylimino-1,3-thiazolidin-4-yl)methylamino]-4,5-dihydro-1H-imidazol-5-yl]ethanimidamide.
| Compound Name | 2-[2-[(2-methylimino-1,3-thiazolidin-4-yl)methylamino]-4,5-dihydro-1H-imidazol-5-yl]ethanimidamide |
|---|---|
| PubChem CID | 152984781 |
| Molecular Formula | C10H19N7S |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[2-[(2-methylimino-1,3-thiazolidin-4-yl)methylamino]-4,5-dihydro-1H-imidazol-5-yl]ethanimidamide |
| SMILES | [H]/N=C(\N)CC1CN=C(NCC2CS/C(=N\C)N2)N1 |
| InChI | InChI=1S/C10H19N7S/c1-13-10-17-7(5-18-10)4-15-9-14-3-6(16-9)2-8(11)12/h6-7H,2-5H2,1H3,(H3,11,12)(H,13,17)(H2,14,15,16) |
| InChIKey | UVCBTUPQTKNKGO-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|