C36H50IN4O8- — CID 152986717
CID 152986717 (PubChem CID 152986717) has the molecular formula C36H50IN4O8- and a molecular weight of 793.72 g/mol.
| Compound Name | CID 152986717 |
|---|---|
| PubChem CID | 152986717 |
| Molecular Formula | C36H50IN4O8- |
| Molecular Weight | 793.72 g/mol |
| Exact Mass | 793.27 |
| IUPAC Name | — |
| SMILES | CCCCN(C(=O)CN1C[C@H](c2cc(OC)c3c(c2)OCO3)[C@@H](C(=O)O)[C@@H]1CCN1CCC(=O)N(C)C1=O)c1cccc(C[I-](C)(C)C)c1 |
| InChI | InChI=1S/C36H50IN4O8/c1-7-8-14-41(26-11-9-10-24(17-26)20-37(2,3)4)32(43)22-40-21-27(25-18-29(47-6)34-30(19-25)48-23-49-34)33(35(44)45)28(40)12-15-39-16-13-31(42)38(5)36(39)46/h9-11,17-19,27-28,33H,7-8,12-16,20-23H2,1-6H3,(H,44,45)/q-1/t27-,28+,33-/m1/s1 |
| InChIKey | IPOFPWXPHUYCDE-XYEMOUPBSA-N |
| XLogP | 0.95 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.72 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|