C33H34ClN5O5 — CID 152987346
(E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]pent-3-en-2-one (PubChem CID 152987346) has the molecular formula C33H34ClN5O5 and a molecular weight of 616.12 g/mol. Its IUPAC name is (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 152987346 |
| Molecular Formula | C33H34ClN5O5 |
| Molecular Weight | 616.12 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]pent-3-en-2-one |
| SMILES | CCOc1cc2ncnc(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1CC(=O)/C=C/CN1C[C@@H]2OCCO[C@@H]2C1 |
| InChI | InChI=1S/C33H34ClN5O5/c1-2-41-30-17-28-26(15-22(30)14-25(40)7-5-11-39-18-31-32(19-39)43-13-12-42-31)33(37-21-36-28)38-23-8-9-29(27(34)16-23)44-20-24-6-3-4-10-35-24/h3-10,15-17,21,31-32H,2,11-14,18-20H2,1H3,(H,36,37,38)/b7-5+/t31-,32+ |
| InChIKey | UVOOOSUJKREGKB-MFZNJMQNSA-N |
| XLogP | 5.17 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.12 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|