About (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide
(E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide (PubChem CID 152990810) has the molecular formula C14H22FNO2
and a molecular weight of 255.33 g/mol. Its IUPAC name is (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide |
| PubChem CID | 152990810 |
| Molecular Formula | C14H22FNO2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide |
| SMILES | C/C(=C\C(=O)CC(C)C)CC(C)NC(=O)/C=C/F |
| InChI | InChI=1S/C14H22FNO2/c1-10(2)7-13(17)9-11(3)8-12(4)16-14(18)5-6-15/h5-6,9-10,12H,7-8H2,1-4H3,(H,16,18)/b6-5+,11-9+ |
| InChIKey | UWFRVWSEESROPN-ZMLXFWSASA-N |
| XLogP | 2.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide?
The IUPAC name of (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide (CID 152990810) is (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide.
What is the SMILES notation for (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide?
The canonical SMILES for (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide is C/C(=C\C(=O)CC(C)C)CC(C)NC(=O)/C=C/F.
What is the InChIKey of (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide?
The InChIKey is UWFRVWSEESROPN-ZMLXFWSASA-N. The full InChI is InChI=1S/C14H22FNO2/c1-10(2)7-13(17)9-11(3)8-12(4)16-14(18)5-6-15/h5-6,9-10,12H,7-8H2,1-4H3,(H,16,18)/b6-5+,11-9+.
What are the key properties of (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide?
(E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide has a molecular weight of 255.33 g/mol, XLogP of 2.93, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(E)-4,8-dimethyl-6-oxonon-4-en-2-yl]-3-fluoroprop-2-enamide is sourced from PubChem (CID 152990810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).