C21H28N4O4 — CID 152991568
2-N-[1-(5-imino-6,6-dimethyl-2-oxo-1,3-oxazepan-4-ylidene)hexyl]benzene-1,2-dicarboxamide (PubChem CID 152991568) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-N-[1-(5-imino-6,6-dimethyl-2-oxo-1,3-oxazepan-4-ylidene)hexyl]benzene-1,2-dicarboxamide.
| Compound Name | 2-N-[1-(5-imino-6,6-dimethyl-2-oxo-1,3-oxazepan-4-ylidene)hexyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 152991568 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-N-[1-(5-imino-6,6-dimethyl-2-oxo-1,3-oxazepan-4-ylidene)hexyl]benzene-1,2-dicarboxamide |
| SMILES | [H]/N=C1/C(=C(CCCCC)NC(=O)c2ccccc2C(N)=O)NC(=O)OCC1(C)C |
| InChI | InChI=1S/C21H28N4O4/c1-4-5-6-11-15(16-17(22)21(2,3)12-29-20(28)25-16)24-19(27)14-10-8-7-9-13(14)18(23)26/h7-10,22H,4-6,11-12H2,1-3H3,(H2,23,26)(H,24,27)(H,25,28)/b16-15?,22-17- |
| InChIKey | GGZUYCSGUDGZSG-CKJTUIDBSA-N |
| XLogP | 3.09 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|