C13H24N2 — CID 152996331
(E,4R)-7-imino-N,4,5-trimethyl-N-[(Z)-prop-1-enyl]hept-5-en-2-amine (PubChem CID 152996331) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (E,4R)-7-imino-N,4,5-trimethyl-N-[(Z)-prop-1-enyl]hept-5-en-2-amine.
| Compound Name | (E,4R)-7-imino-N,4,5-trimethyl-N-[(Z)-prop-1-enyl]hept-5-en-2-amine |
|---|---|
| PubChem CID | 152996331 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (E,4R)-7-imino-N,4,5-trimethyl-N-[(Z)-prop-1-enyl]hept-5-en-2-amine |
| SMILES | [H]/N=C/C=C(\C)[C@H](C)CC(C)N(C)/C=C\C |
| InChI | InChI=1S/C13H24N2/c1-6-9-15(5)13(4)10-12(3)11(2)7-8-14/h6-9,12-14H,10H2,1-5H3/b9-6-,11-7+,14-8+/t12-,13?/m1/s1 |
| InChIKey | UXGVLBCQQTWLQR-PIQPQNSWSA-N |
| XLogP | 3.46 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|