C28H29ClFNO4S2 — CID 152997774
4-[5-[(1R,2S)-1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]thiophen-2-yl]-4-oxobutane-1-sulfonic acid (PubChem CID 152997774) has the molecular formula C28H29ClFNO4S2 and a molecular weight of 562.13 g/mol. Its IUPAC name is 4-[5-[(1R,2S)-1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]thiophen-2-yl]-4-oxobutane-1-sulfonic acid.
| Compound Name | 4-[5-[(1R,2S)-1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]thiophen-2-yl]-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 152997774 |
| Molecular Formula | C28H29ClFNO4S2 |
| Molecular Weight | 562.13 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 4-[5-[(1R,2S)-1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]thiophen-2-yl]-4-oxobutane-1-sulfonic acid |
| SMILES | CCC[C@H](c1ccc(C(=O)CCCS(=O)(=O)O)s1)[C@H](c1ccc(Cl)cc1)c1c[nH]c2c(F)cc(C)cc12 |
| InChI | InChI=1S/C28H29ClFNO4S2/c1-3-5-20(25-11-12-26(36-25)24(32)6-4-13-37(33,34)35)27(18-7-9-19(29)10-8-18)22-16-31-28-21(22)14-17(2)15-23(28)30/h7-12,14-16,20,27,31H,3-6,13H2,1-2H3,(H,33,34,35)/t20-,27+/m1/s1 |
| InChIKey | UXOGPIGOFOXALX-HRFSGMKKSA-N |
| XLogP | 7.90 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.13 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|