C26H23F3N6O2 — CID 152998863
[1-(3-methoxyphenyl)-1,2,4-triazol-3-yl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone (PubChem CID 152998863) has the molecular formula C26H23F3N6O2 and a molecular weight of 508.50 g/mol. Its IUPAC name is [1-(3-methoxyphenyl)-1,2,4-triazol-3-yl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone.
| Compound Name | [1-(3-methoxyphenyl)-1,2,4-triazol-3-yl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 152998863 |
| Molecular Formula | C26H23F3N6O2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | [1-(3-methoxyphenyl)-1,2,4-triazol-3-yl]-[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
| SMILES | COc1cccc(-n2cnc(C(=O)N3[C@H]4CCC[C@@H]3c3nn(C)c(-c5cc(F)c(F)c(F)c5)c3C4)n2)c1 |
| InChI | InChI=1S/C26H23F3N6O2/c1-33-24(14-9-19(27)22(29)20(28)10-14)18-12-16-6-4-8-21(23(18)31-33)35(16)26(36)25-30-13-34(32-25)15-5-3-7-17(11-15)37-2/h3,5,7,9-11,13,16,21H,4,6,8,12H2,1-2H3/t16-,21+/m0/s1 |
| InChIKey | UXTNOTGXPQVVON-HRAATJIYSA-N |
| XLogP | 4.39 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|