C13H12N4 — CID 1530
1-methyl-6-phenylimidazo[4,5-b]pyridin-2-amine (PubChem CID 1530) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 1-methyl-6-phenylimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 1-methyl-6-phenylimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 1530 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-methyl-6-phenylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Cn1c(N)nc2ncc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C13H12N4/c1-17-11-7-10(9-5-3-2-4-6-9)8-15-12(11)16-13(17)14/h2-8H,1H3,(H2,14,15,16) |
| InChIKey | UQVKZNNCIHJZLS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |