C19H29N5 — CID 153002259
6-imino-1,2,2,10-tetramethyl-3,5a,6a,7,8,9,11,11a-octahydro-1H-pyrrolo[2,3-c]acridine-5,9-diamine (PubChem CID 153002259) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 6-imino-1,2,2,10-tetramethyl-3,5a,6a,7,8,9,11,11a-octahydro-1H-pyrrolo[2,3-c]acridine-5,9-diamine.
| Compound Name | 6-imino-1,2,2,10-tetramethyl-3,5a,6a,7,8,9,11,11a-octahydro-1H-pyrrolo[2,3-c]acridine-5,9-diamine |
|---|---|
| PubChem CID | 153002259 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 6-imino-1,2,2,10-tetramethyl-3,5a,6a,7,8,9,11,11a-octahydro-1H-pyrrolo[2,3-c]acridine-5,9-diamine |
| SMILES | [H]/N=C1\C2CCC(N)C(C)=C2NC2C3=C(C=C(N)C12)NC(C)(C)C3C |
| InChI | InChI=1S/C19H29N5/c1-8-11(20)6-5-10-16(22)15-12(21)7-13-14(18(15)23-17(8)10)9(2)19(3,4)24-13/h7,9-11,15,18,22-24H,5-6,20-21H2,1-4H3/b22-16+ |
| InChIKey | UYJVLQDGDOBBJM-CJLVFECKSA-N |
| XLogP | 1.73 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|