(E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid

C9H10O4 — CID 153002577

IUPAC(E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid
SMILESO=C(O)/C=C/C1=CC(O)=C(O)CC1
InChIInChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h2,4-5,10-11H,1,3H2,(H,12,13)/b4-2+
InChIKeyUYLLQCPFUNIZIO-DUXPYHPUSA-N
MW182.18 g/mol
LogP1.67
Rot. Bonds2

About (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid

(E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid (PubChem CID 153002577) has the molecular formula C9H10O4 and a molecular weight of 182.18 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid
PubChem CID153002577
Molecular FormulaC9H10O4
Molecular Weight182.18 g/mol
Exact Mass182.06
IUPAC Name(E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid
SMILESO=C(O)/C=C/C1=CC(O)=C(O)CC1
InChIInChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h2,4-5,10-11H,1,3H2,(H,12,13)/b4-2+
InChIKeyUYLLQCPFUNIZIO-DUXPYHPUSA-N
XLogP1.67
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.18
LogP ≤ 51.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid?
The IUPAC name of (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid (CID 153002577) is (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid is O=C(O)/C=C/C1=CC(O)=C(O)CC1.
What is the InChIKey of (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid?
The InChIKey is UYLLQCPFUNIZIO-DUXPYHPUSA-N. The full InChI is InChI=1S/C9H10O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h2,4-5,10-11H,1,3H2,(H,12,13)/b4-2+.
What are the key properties of (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid?
(E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid has a molecular weight of 182.18 g/mol, XLogP of 1.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,4-dihydroxycyclohexa-1,3-dien-1-yl)prop-2-enoic acid is sourced from PubChem (CID 153002577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).