C20H6N6O8S2 — CID 153005881
6,13-bis(5-nitro-1,3-thiazol-2-yl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 153005881) has the molecular formula C20H6N6O8S2 and a molecular weight of 522.44 g/mol. Its IUPAC name is 6,13-bis(5-nitro-1,3-thiazol-2-yl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis(5-nitro-1,3-thiazol-2-yl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 153005881 |
| Molecular Formula | C20H6N6O8S2 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.97 |
| IUPAC Name | 6,13-bis(5-nitro-1,3-thiazol-2-yl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1c1ncc([N+](=O)[O-])s1)C(=O)N(c1ncc([N+](=O)[O-])s1)C3=O |
| InChI | InChI=1S/C20H6N6O8S2/c27-15-7-1-2-8-14-10(18(30)24(16(8)28)20-22-6-12(36-20)26(33)34)4-3-9(13(7)14)17(29)23(15)19-21-5-11(35-19)25(31)32/h1-6H |
| InChIKey | UZBWRFVMPAUNCB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 186.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|