C24H25N5O3 — CID 153008018
(3aR,8bS)-5-[5-[(E)-2-[amino(benzyl)amino]ethenyl]-1,2,4-oxadiazol-3-yl]-1-(2-hydroxyethyl)-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one (PubChem CID 153008018) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is (3aR,8bS)-5-[5-[(E)-2-[amino(benzyl)amino]ethenyl]-1,2,4-oxadiazol-3-yl]-1-(2-hydroxyethyl)-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one.
| Compound Name | (3aR,8bS)-5-[5-[(E)-2-[amino(benzyl)amino]ethenyl]-1,2,4-oxadiazol-3-yl]-1-(2-hydroxyethyl)-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 153008018 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (3aR,8bS)-5-[5-[(E)-2-[amino(benzyl)amino]ethenyl]-1,2,4-oxadiazol-3-yl]-1-(2-hydroxyethyl)-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
| SMILES | NN(/C=C/c1nc(-c2cccc3c2C[C@@H]2CC(=O)N(CCO)[C@H]32)no1)Cc1ccccc1 |
| InChI | InChI=1S/C24H25N5O3/c25-28(15-16-5-2-1-3-6-16)10-9-21-26-24(27-32-21)19-8-4-7-18-20(19)13-17-14-22(31)29(11-12-30)23(17)18/h1-10,17,23,30H,11-15,25H2/b10-9+/t17-,23+/m1/s1 |
| InChIKey | UZMVJRNKDLFYRN-JTORVKOUSA-N |
| XLogP | 2.52 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|